C15H27ClSi — CID 141235544
chloro-dimethyl-(3-octylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 141235544) has the molecular formula C15H27ClSi and a molecular weight of 270.92 g/mol. Its IUPAC name is chloro-dimethyl-(3-octylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | chloro-dimethyl-(3-octylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 141235544 |
| Molecular Formula | C15H27ClSi |
| Molecular Weight | 270.92 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | chloro-dimethyl-(3-octylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCCCCCCCC1=CC([Si](C)(C)Cl)C=C1 |
| InChI | InChI=1S/C15H27ClSi/c1-4-5-6-7-8-9-10-14-11-12-15(13-14)17(2,3)16/h11-13,15H,4-10H2,1-3H3 |
| InChIKey | QVSOPKXZANAWLL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.92 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|