C19H33Cl — CID 130459982
(6R)-6-chloro-2-ethyl-5-undecylcyclohexa-1,3-diene (PubChem CID 130459982) has the molecular formula C19H33Cl and a molecular weight of 296.93 g/mol. Its IUPAC name is (6R)-6-chloro-2-ethyl-5-undecylcyclohexa-1,3-diene.
| Compound Name | (6R)-6-chloro-2-ethyl-5-undecylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 130459982 |
| Molecular Formula | C19H33Cl |
| Molecular Weight | 296.93 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (6R)-6-chloro-2-ethyl-5-undecylcyclohexa-1,3-diene |
| SMILES | CCCCCCCCCCCC1C=CC(CC)=C[C@@H]1Cl |
| InChI | InChI=1S/C19H33Cl/c1-3-5-6-7-8-9-10-11-12-13-18-15-14-17(4-2)16-19(18)20/h14-16,18-19H,3-13H2,1-2H3/t18?,19-/m0/s1 |
| InChIKey | FRYSSRZCTALGFR-GGYWPGCISA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.93 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|