C13H20 — CID 142148420
5-ethenyl-2-ethyl-6-propylcyclohexa-1,3-diene (PubChem CID 142148420) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-ethenyl-2-ethyl-6-propylcyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-2-ethyl-6-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142148420 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-ethenyl-2-ethyl-6-propylcyclohexa-1,3-diene |
| SMILES | C=CC1C=CC(CC)=CC1CCC |
| InChI | InChI=1S/C13H20/c1-4-7-13-10-11(5-2)8-9-12(13)6-3/h6,8-10,12-13H,3-5,7H2,1-2H3 |
| InChIKey | KYRPGIPUCUCIFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|