C13H20O — CID 145190704
2-ethyl-5-propylcyclohexa-1,3-diene;ethynol (PubChem CID 145190704) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-ethyl-5-propylcyclohexa-1,3-diene;ethynol.
| Compound Name | 2-ethyl-5-propylcyclohexa-1,3-diene;ethynol |
|---|---|
| PubChem CID | 145190704 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-ethyl-5-propylcyclohexa-1,3-diene;ethynol |
| SMILES | C#CO.CCCC1C=CC(CC)=CC1 |
| InChI | InChI=1S/C11H18.C2H2O/c1-3-5-11-8-6-10(4-2)7-9-11;1-2-3/h6-8,11H,3-5,9H2,1-2H3;1,3H |
| InChIKey | ZMAPVPQJTORNJO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|