C17H29FO — CID 122432431
2-[[(5S)-decan-5-yl]oxymethyl]-5-fluorocyclohexa-1,3-diene (PubChem CID 122432431) has the molecular formula C17H29FO and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-[[(5S)-decan-5-yl]oxymethyl]-5-fluorocyclohexa-1,3-diene.
| Compound Name | 2-[[(5S)-decan-5-yl]oxymethyl]-5-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 122432431 |
| Molecular Formula | C17H29FO |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-[[(5S)-decan-5-yl]oxymethyl]-5-fluorocyclohexa-1,3-diene |
| SMILES | CCCCC[C@H](CCCC)OCC1=CCC(F)C=C1 |
| InChI | InChI=1S/C17H29FO/c1-3-5-7-9-17(8-6-4-2)19-14-15-10-12-16(18)13-11-15/h10-12,16-17H,3-9,13-14H2,1-2H3/t16?,17-/m0/s1 |
| InChIKey | SYWJOWOBNHINQI-DJNXLDHESA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|