About 9-ethoxyoctadecane
9-ethoxyoctadecane (PubChem CID 87148376) has the molecular formula C20H42O
and a molecular weight of 298.55 g/mol. Its IUPAC name is 9-ethoxyoctadecane.
Molecular Properties
| Compound Name | 9-ethoxyoctadecane |
| PubChem CID | 87148376 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 9-ethoxyoctadecane |
| SMILES | CCCCCCCCCC(CCCCCCCC)OCC |
| InChI | InChI=1S/C20H42O/c1-4-7-9-11-13-15-17-19-20(21-6-3)18-16-14-12-10-8-5-2/h20H,4-19H2,1-3H3 |
| InChIKey | YOOZECFEWBDPSR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-ethoxyoctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethoxyoctadecane?
The IUPAC name of 9-ethoxyoctadecane (CID 87148376) is 9-ethoxyoctadecane.
What is the SMILES notation for 9-ethoxyoctadecane?
The canonical SMILES for 9-ethoxyoctadecane is CCCCCCCCCC(CCCCCCCC)OCC.
What is the InChIKey of 9-ethoxyoctadecane?
The InChIKey is YOOZECFEWBDPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O/c1-4-7-9-11-13-15-17-19-20(21-6-3)18-16-14-12-10-8-5-2/h20H,4-19H2,1-3H3.
What are the key properties of 9-ethoxyoctadecane?
9-ethoxyoctadecane has a molecular weight of 298.55 g/mol, XLogP of 7.28, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethoxyoctadecane is sourced from PubChem (CID 87148376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).