C15H32O3 — CID 3084722
(3S)-1,1,3-triethoxynonane (PubChem CID 3084722) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is (3S)-1,1,3-triethoxynonane.
| Compound Name | (3S)-1,1,3-triethoxynonane |
|---|---|
| PubChem CID | 3084722 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | (3S)-1,1,3-triethoxynonane |
| SMILES | CCCCCC[C@@H](CC(OCC)OCC)OCC |
| InChI | InChI=1S/C15H32O3/c1-5-9-10-11-12-14(16-6-2)13-15(17-7-3)18-8-4/h14-15H,5-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | JWXUYKOCPKYCHJ-AWEZNQCLSA-N |
| XLogP | 4.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|