4-ethoxydodecane;sulfuric acid

C14H32O5S — CID 87841741

IUPAC4-ethoxydodecane;sulfuric acid
SMILESCCCCCCCCC(CCC)OCC.O=S(=O)(O)O
InChIInChI=1S/C14H30O.H2O4S/c1-4-7-8-9-10-11-13-14(12-5-2)15-6-3;1-5(2,3)4/h14H,4-13H2,1-3H3;(H2,1,2,3,4)
InChIKeyKWNVQIURBRMLDN-UHFFFAOYSA-N
MW312.47 g/mol
LogP4.29
Rot. Bonds11

About 4-ethoxydodecane;sulfuric acid

4-ethoxydodecane;sulfuric acid (PubChem CID 87841741) has the molecular formula C14H32O5S and a molecular weight of 312.47 g/mol. Its IUPAC name is 4-ethoxydodecane;sulfuric acid.

Molecular Properties

Compound Name4-ethoxydodecane;sulfuric acid
PubChem CID87841741
Molecular FormulaC14H32O5S
Molecular Weight312.47 g/mol
Exact Mass312.20
IUPAC Name4-ethoxydodecane;sulfuric acid
SMILESCCCCCCCCC(CCC)OCC.O=S(=O)(O)O
InChIInChI=1S/C14H30O.H2O4S/c1-4-7-8-9-10-11-13-14(12-5-2)15-6-3;1-5(2,3)4/h14H,4-13H2,1-3H3;(H2,1,2,3,4)
InChIKeyKWNVQIURBRMLDN-UHFFFAOYSA-N
XLogP4.29
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.47
LogP ≤ 54.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-ethoxydodecane;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethoxydodecane;sulfuric acid?
The IUPAC name of 4-ethoxydodecane;sulfuric acid (CID 87841741) is 4-ethoxydodecane;sulfuric acid.
What is the SMILES notation for 4-ethoxydodecane;sulfuric acid?
The canonical SMILES for 4-ethoxydodecane;sulfuric acid is CCCCCCCCC(CCC)OCC.O=S(=O)(O)O.
What is the InChIKey of 4-ethoxydodecane;sulfuric acid?
The InChIKey is KWNVQIURBRMLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O.H2O4S/c1-4-7-8-9-10-11-13-14(12-5-2)15-6-3;1-5(2,3)4/h14H,4-13H2,1-3H3;(H2,1,2,3,4).
What are the key properties of 4-ethoxydodecane;sulfuric acid?
4-ethoxydodecane;sulfuric acid has a molecular weight of 312.47 g/mol, XLogP of 4.29, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxydodecane;sulfuric acid is sourced from PubChem (CID 87841741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).