About sodium;9-methanidyloctadecane;sulfuric acid
sodium;9-methanidyloctadecane;sulfuric acid (PubChem CID 174994475) has the molecular formula C19H41NaO4S
and a molecular weight of 388.59 g/mol. Its IUPAC name is sodium;9-methanidyloctadecane;sulfuric acid.
Molecular Properties
| Compound Name | sodium;9-methanidyloctadecane;sulfuric acid |
| PubChem CID | 174994475 |
| Molecular Formula | C19H41NaO4S |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | sodium;9-methanidyloctadecane;sulfuric acid |
| SMILES | O=S(=O)(O)O.[CH2-]C(CCCCCCCC)CCCCCCCCC.[Na+] |
| InChI | InChI=1S/C19H39.Na.H2O4S/c1-4-6-8-10-12-14-16-18-19(3)17-15-13-11-9-7-5-2;;1-5(2,3)4/h19H,3-18H2,1-2H3;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | OWCIZTCOVZGGOJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;9-methanidyloctadecane;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;9-methanidyloctadecane;sulfuric acid?
The IUPAC name of sodium;9-methanidyloctadecane;sulfuric acid (CID 174994475) is sodium;9-methanidyloctadecane;sulfuric acid.
What is the SMILES notation for sodium;9-methanidyloctadecane;sulfuric acid?
The canonical SMILES for sodium;9-methanidyloctadecane;sulfuric acid is O=S(=O)(O)O.[CH2-]C(CCCCCCCC)CCCCCCCCC.[Na+].
What is the InChIKey of sodium;9-methanidyloctadecane;sulfuric acid?
The InChIKey is OWCIZTCOVZGGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39.Na.H2O4S/c1-4-6-8-10-12-14-16-18-19(3)17-15-13-11-9-7-5-2;;1-5(2,3)4/h19H,3-18H2,1-2H3;;(H2,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;9-methanidyloctadecane;sulfuric acid?
sodium;9-methanidyloctadecane;sulfuric acid has a molecular weight of 388.59 g/mol, XLogP of 3.68, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;9-methanidyloctadecane;sulfuric acid is sourced from PubChem (CID 174994475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).