About dodecane-5-sulfonic acid
dodecane-5-sulfonic acid (PubChem CID 87491021) has the molecular formula C12H26O3S
and a molecular weight of 250.40 g/mol. Its IUPAC name is dodecane-5-sulfonic acid.
Molecular Properties
| Compound Name | dodecane-5-sulfonic acid |
| PubChem CID | 87491021 |
| Molecular Formula | C12H26O3S |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | dodecane-5-sulfonic acid |
| SMILES | CCCCCCCC(CCCC)S(=O)(=O)O |
| InChI | InChI=1S/C12H26O3S/c1-3-5-7-8-9-11-12(10-6-4-2)16(13,14)15/h12H,3-11H2,1-2H3,(H,13,14,15) |
| InChIKey | BSQQGKMAIODZDZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dodecane-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecane-5-sulfonic acid?
The IUPAC name of dodecane-5-sulfonic acid (CID 87491021) is dodecane-5-sulfonic acid.
What is the SMILES notation for dodecane-5-sulfonic acid?
The canonical SMILES for dodecane-5-sulfonic acid is CCCCCCCC(CCCC)S(=O)(=O)O.
What is the InChIKey of dodecane-5-sulfonic acid?
The InChIKey is BSQQGKMAIODZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3S/c1-3-5-7-8-9-11-12(10-6-4-2)16(13,14)15/h12H,3-11H2,1-2H3,(H,13,14,15).
What are the key properties of dodecane-5-sulfonic acid?
dodecane-5-sulfonic acid has a molecular weight of 250.40 g/mol, XLogP of 3.79, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecane-5-sulfonic acid is sourced from PubChem (CID 87491021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).