About octadecane-9-sulfonic acid
octadecane-9-sulfonic acid (PubChem CID 19700233) has the molecular formula C18H38O3S
and a molecular weight of 334.57 g/mol. Its IUPAC name is octadecane-9-sulfonic acid.
Molecular Properties
| Compound Name | octadecane-9-sulfonic acid |
| PubChem CID | 19700233 |
| Molecular Formula | C18H38O3S |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | octadecane-9-sulfonic acid |
| SMILES | CCCCCCCCCC(CCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C18H38O3S/c1-3-5-7-9-11-13-15-17-18(22(19,20)21)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2H3,(H,19,20,21) |
| InChIKey | VDGAWAMLIWAHQA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze octadecane-9-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecane-9-sulfonic acid?
The IUPAC name of octadecane-9-sulfonic acid (CID 19700233) is octadecane-9-sulfonic acid.
What is the SMILES notation for octadecane-9-sulfonic acid?
The canonical SMILES for octadecane-9-sulfonic acid is CCCCCCCCCC(CCCCCCCC)S(=O)(=O)O.
What is the InChIKey of octadecane-9-sulfonic acid?
The InChIKey is VDGAWAMLIWAHQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O3S/c1-3-5-7-9-11-13-15-17-18(22(19,20)21)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2H3,(H,19,20,21).
What are the key properties of octadecane-9-sulfonic acid?
octadecane-9-sulfonic acid has a molecular weight of 334.57 g/mol, XLogP of 6.13, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecane-9-sulfonic acid is sourced from PubChem (CID 19700233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).