C24H50O7S — CID 118576673
2-[2-(2-octadecan-9-yloxyethoxy)ethoxy]ethyl hydrogen sulfate (PubChem CID 118576673) has the molecular formula C24H50O7S and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-[2-(2-octadecan-9-yloxyethoxy)ethoxy]ethyl hydrogen sulfate.
| Compound Name | 2-[2-(2-octadecan-9-yloxyethoxy)ethoxy]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 118576673 |
| Molecular Formula | C24H50O7S |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 2-[2-(2-octadecan-9-yloxyethoxy)ethoxy]ethyl hydrogen sulfate |
| SMILES | CCCCCCCCCC(CCCCCCCC)OCCOCCOCCOS(=O)(=O)O |
| InChI | InChI=1S/C24H50O7S/c1-3-5-7-9-11-13-15-17-24(16-14-12-10-8-6-4-2)30-22-20-28-18-19-29-21-23-31-32(25,26)27/h24H,3-23H2,1-2H3,(H,25,26,27) |
| InChIKey | VIWKNFWESNTNCF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|