About 5-ethoxynonane
5-ethoxynonane (PubChem CID 91187482) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 5-ethoxynonane.
Molecular Properties
| Compound Name | 5-ethoxynonane |
| PubChem CID | 91187482 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 5-ethoxynonane |
| SMILES | CCCCC(CCCC)OCC |
| InChI | InChI=1S/C11H24O/c1-4-7-9-11(12-6-3)10-8-5-2/h11H,4-10H2,1-3H3 |
| InChIKey | NMPVUPXNGUHBKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethoxynonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxynonane?
The IUPAC name of 5-ethoxynonane (CID 91187482) is 5-ethoxynonane.
What is the SMILES notation for 5-ethoxynonane?
The canonical SMILES for 5-ethoxynonane is CCCCC(CCCC)OCC.
What is the InChIKey of 5-ethoxynonane?
The InChIKey is NMPVUPXNGUHBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O/c1-4-7-9-11(12-6-3)10-8-5-2/h11H,4-10H2,1-3H3.
What are the key properties of 5-ethoxynonane?
5-ethoxynonane has a molecular weight of 172.31 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxynonane is sourced from PubChem (CID 91187482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).