About 3-ethoxy-1,5-difluoropentane
3-ethoxy-1,5-difluoropentane (PubChem CID 54263170) has the molecular formula C7H14F2O
and a molecular weight of 152.18 g/mol. Its IUPAC name is 3-ethoxy-1,5-difluoropentane.
Molecular Properties
| Compound Name | 3-ethoxy-1,5-difluoropentane |
| PubChem CID | 54263170 |
| Molecular Formula | C7H14F2O |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | 3-ethoxy-1,5-difluoropentane |
| SMILES | CCOC(CCF)CCF |
| InChI | InChI=1S/C7H14F2O/c1-2-10-7(3-5-8)4-6-9/h7H,2-6H2,1H3 |
| InChIKey | REXYEEVEQSBNIY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethoxy-1,5-difluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1,5-difluoropentane?
The IUPAC name of 3-ethoxy-1,5-difluoropentane (CID 54263170) is 3-ethoxy-1,5-difluoropentane.
What is the SMILES notation for 3-ethoxy-1,5-difluoropentane?
The canonical SMILES for 3-ethoxy-1,5-difluoropentane is CCOC(CCF)CCF.
What is the InChIKey of 3-ethoxy-1,5-difluoropentane?
The InChIKey is REXYEEVEQSBNIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2O/c1-2-10-7(3-5-8)4-6-9/h7H,2-6H2,1H3.
What are the key properties of 3-ethoxy-1,5-difluoropentane?
3-ethoxy-1,5-difluoropentane has a molecular weight of 152.18 g/mol, XLogP of 2.11, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1,5-difluoropentane is sourced from PubChem (CID 54263170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).