About 3-ethoxyheptane-1,7-diol
3-ethoxyheptane-1,7-diol (PubChem CID 57097049) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethoxyheptane-1,7-diol.
Molecular Properties
| Compound Name | 3-ethoxyheptane-1,7-diol |
| PubChem CID | 57097049 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 3-ethoxyheptane-1,7-diol |
| SMILES | CCOC(CCO)CCCCO |
| InChI | InChI=1S/C9H20O3/c1-2-12-9(6-8-11)5-3-4-7-10/h9-11H,2-8H2,1H3 |
| InChIKey | KJMOLKPUKUJTJD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxyheptane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyheptane-1,7-diol?
The IUPAC name of 3-ethoxyheptane-1,7-diol (CID 57097049) is 3-ethoxyheptane-1,7-diol.
What is the SMILES notation for 3-ethoxyheptane-1,7-diol?
The canonical SMILES for 3-ethoxyheptane-1,7-diol is CCOC(CCO)CCCCO.
What is the InChIKey of 3-ethoxyheptane-1,7-diol?
The InChIKey is KJMOLKPUKUJTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3/c1-2-12-9(6-8-11)5-3-4-7-10/h9-11H,2-8H2,1H3.
What are the key properties of 3-ethoxyheptane-1,7-diol?
3-ethoxyheptane-1,7-diol has a molecular weight of 176.26 g/mol, XLogP of 0.94, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyheptane-1,7-diol is sourced from PubChem (CID 57097049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).