About (2S)-2-ethoxybutane-1,4-diol
(2S)-2-ethoxybutane-1,4-diol (PubChem CID 89342985) has the molecular formula C6H14O3
and a molecular weight of 134.18 g/mol. Its IUPAC name is (2S)-2-ethoxybutane-1,4-diol.
Molecular Properties
| Compound Name | (2S)-2-ethoxybutane-1,4-diol |
| PubChem CID | 89342985 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (2S)-2-ethoxybutane-1,4-diol |
| SMILES | CCO[C@H](CO)CCO |
| InChI | InChI=1S/C6H14O3/c1-2-9-6(5-8)3-4-7/h6-8H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | IRZLMNRFLJUTJZ-LURJTMIESA-N |
| XLogP | -0.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-ethoxybutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethoxybutane-1,4-diol?
The IUPAC name of (2S)-2-ethoxybutane-1,4-diol (CID 89342985) is (2S)-2-ethoxybutane-1,4-diol.
What is the SMILES notation for (2S)-2-ethoxybutane-1,4-diol?
The canonical SMILES for (2S)-2-ethoxybutane-1,4-diol is CCO[C@H](CO)CCO.
What is the InChIKey of (2S)-2-ethoxybutane-1,4-diol?
The InChIKey is IRZLMNRFLJUTJZ-LURJTMIESA-N. The full InChI is InChI=1S/C6H14O3/c1-2-9-6(5-8)3-4-7/h6-8H,2-5H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-2-ethoxybutane-1,4-diol?
(2S)-2-ethoxybutane-1,4-diol has a molecular weight of 134.18 g/mol, XLogP of -0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethoxybutane-1,4-diol is sourced from PubChem (CID 89342985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).