C7H16O3 — CID 129362297
(2R)-2,3-diethoxypropan-1-ol (PubChem CID 129362297) has the molecular formula C7H16O3 and a molecular weight of 148.20 g/mol. Its IUPAC name is (2R)-2,3-diethoxypropan-1-ol.
| Compound Name | (2R)-2,3-diethoxypropan-1-ol |
|---|---|
| PubChem CID | 129362297 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (2R)-2,3-diethoxypropan-1-ol |
| SMILES | CCOC[C@@H](CO)OCC |
| InChI | InChI=1S/C7H16O3/c1-3-9-6-7(5-8)10-4-2/h7-8H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | CCLNWKPQPZBSEI-SSDOTTSWSA-N |
| XLogP | 0.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |