C7H16INO2 — CID 166782054
2,3-diethoxy-N-iodopropan-1-amine (PubChem CID 166782054) has the molecular formula C7H16INO2 and a molecular weight of 273.11 g/mol. Its IUPAC name is 2,3-diethoxy-N-iodopropan-1-amine.
| Compound Name | 2,3-diethoxy-N-iodopropan-1-amine |
|---|---|
| PubChem CID | 166782054 |
| Molecular Formula | C7H16INO2 |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2,3-diethoxy-N-iodopropan-1-amine |
| SMILES | CCOCC(CNI)OCC |
| InChI | InChI=1S/C7H16INO2/c1-3-10-6-7(5-9-8)11-4-2/h7,9H,3-6H2,1-2H3 |
| InChIKey | WGTYXTWSVJIZLC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|