C14H30O5 — CID 87533992
2-(1,3-diethoxypropan-2-yloxy)-1,3-diethoxypropane (PubChem CID 87533992) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-(1,3-diethoxypropan-2-yloxy)-1,3-diethoxypropane.
| Compound Name | 2-(1,3-diethoxypropan-2-yloxy)-1,3-diethoxypropane |
|---|---|
| PubChem CID | 87533992 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-(1,3-diethoxypropan-2-yloxy)-1,3-diethoxypropane |
| SMILES | CCOCC(COCC)OC(COCC)COCC |
| InChI | InChI=1S/C14H30O5/c1-5-15-9-13(10-16-6-2)19-14(11-17-7-3)12-18-8-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | JLMWLYBVXWUBNE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |