About (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane
(2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane (PubChem CID 88965568) has the molecular formula C5H14N2O7
and a molecular weight of 214.17 g/mol. Its IUPAC name is (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane.
Molecular Properties
| Compound Name | (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane |
| PubChem CID | 88965568 |
| Molecular Formula | C5H14N2O7 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane |
| SMILES | CCOC[C@H](CON(O)O)ON(O)O |
| InChI | InChI=1S/C5H14N2O7/c1-2-12-3-5(14-7(10)11)4-13-6(8)9/h5,8-11H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | JFONFILKRKTYCJ-RXMQYKEDSA-N |
| XLogP | -0.58 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane?
The IUPAC name of (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane (CID 88965568) is (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane.
What is the SMILES notation for (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane?
The canonical SMILES for (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane is CCOC[C@H](CON(O)O)ON(O)O.
What is the InChIKey of (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane?
The InChIKey is JFONFILKRKTYCJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H14N2O7/c1-2-12-3-5(14-7(10)11)4-13-6(8)9/h5,8-11H,2-4H2,1H3/t5-/m1/s1.
What are the key properties of (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane?
(2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane has a molecular weight of 214.17 g/mol, XLogP of -0.58, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane is sourced from PubChem (CID 88965568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).