C5H14N2O7 — CID 88855236
1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane (PubChem CID 88855236) has the molecular formula C5H14N2O7 and a molecular weight of 214.17 g/mol. Its IUPAC name is 1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane.
| Compound Name | 1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane |
|---|---|
| PubChem CID | 88855236 |
| Molecular Formula | C5H14N2O7 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1,2-bis[(dihydroxyamino)oxy]-3-ethoxypropane |
| SMILES | CCOCC(CON(O)O)ON(O)O |
| InChI | InChI=1S/C5H14N2O7/c1-2-12-3-5(14-7(10)11)4-13-6(8)9/h5,8-11H,2-4H2,1H3 |
| InChIKey | JFONFILKRKTYCJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|