C14H24O2 — CID 67553171
benzene;1,2-diethoxybutane (PubChem CID 67553171) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is benzene;1,2-diethoxybutane.
| Compound Name | benzene;1,2-diethoxybutane |
|---|---|
| PubChem CID | 67553171 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | benzene;1,2-diethoxybutane |
| SMILES | CCOCC(CC)OCC.c1ccccc1 |
| InChI | InChI=1S/C8H18O2.C6H6/c1-4-8(10-6-3)7-9-5-2;1-2-4-6-5-3-1/h8H,4-7H2,1-3H3;1-6H |
| InChIKey | QJGFGQGAFOEKNK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |