About 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate
4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate (PubChem CID 87247774) has the molecular formula C15H30O6
and a molecular weight of 306.40 g/mol. Its IUPAC name is 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate.
Molecular Properties
| Compound Name | 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate |
| PubChem CID | 87247774 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate |
| SMILES | CCOCCOC(=O)OCCCCOCC(CC)OCC |
| InChI | InChI=1S/C15H30O6/c1-4-14(19-6-3)13-18-9-7-8-10-20-15(16)21-12-11-17-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | PONUEGRMXIQHGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate?
The IUPAC name of 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate (CID 87247774) is 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate.
What is the SMILES notation for 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate?
The canonical SMILES for 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate is CCOCCOC(=O)OCCCCOCC(CC)OCC.
What is the InChIKey of 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate?
The InChIKey is PONUEGRMXIQHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O6/c1-4-14(19-6-3)13-18-9-7-8-10-20-15(16)21-12-11-17-5-2/h14H,4-13H2,1-3H3.
What are the key properties of 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate?
4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate has a molecular weight of 306.40 g/mol, XLogP of 2.79, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxybutoxy)butyl 2-ethoxyethyl carbonate is sourced from PubChem (CID 87247774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).