About 2-ethoxybutyl ethyl carbonate
2-ethoxybutyl ethyl carbonate (PubChem CID 87247683) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-ethoxybutyl ethyl carbonate.
Molecular Properties
| Compound Name | 2-ethoxybutyl ethyl carbonate |
| PubChem CID | 87247683 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-ethoxybutyl ethyl carbonate |
| SMILES | CCOC(=O)OCC(CC)OCC |
| InChI | InChI=1S/C9H18O4/c1-4-8(11-5-2)7-13-9(10)12-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | PZNCYLKDZLGRII-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxybutyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybutyl ethyl carbonate?
The IUPAC name of 2-ethoxybutyl ethyl carbonate (CID 87247683) is 2-ethoxybutyl ethyl carbonate.
What is the SMILES notation for 2-ethoxybutyl ethyl carbonate?
The canonical SMILES for 2-ethoxybutyl ethyl carbonate is CCOC(=O)OCC(CC)OCC.
What is the InChIKey of 2-ethoxybutyl ethyl carbonate?
The InChIKey is PZNCYLKDZLGRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-4-8(11-5-2)7-13-9(10)12-6-3/h8H,4-7H2,1-3H3.
What are the key properties of 2-ethoxybutyl ethyl carbonate?
2-ethoxybutyl ethyl carbonate has a molecular weight of 190.24 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybutyl ethyl carbonate is sourced from PubChem (CID 87247683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).