About 2-(2-ethoxybutoxy)ethyl methyl carbonate
2-(2-ethoxybutoxy)ethyl methyl carbonate (PubChem CID 87247647) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-(2-ethoxybutoxy)ethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-(2-ethoxybutoxy)ethyl methyl carbonate |
| PubChem CID | 87247647 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(2-ethoxybutoxy)ethyl methyl carbonate |
| SMILES | CCOC(CC)COCCOC(=O)OC |
| InChI | InChI=1S/C10H20O5/c1-4-9(14-5-2)8-13-6-7-15-10(11)12-3/h9H,4-8H2,1-3H3 |
| InChIKey | JQCVUSITCOGIAI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxybutoxy)ethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxybutoxy)ethyl methyl carbonate?
The IUPAC name of 2-(2-ethoxybutoxy)ethyl methyl carbonate (CID 87247647) is 2-(2-ethoxybutoxy)ethyl methyl carbonate.
What is the SMILES notation for 2-(2-ethoxybutoxy)ethyl methyl carbonate?
The canonical SMILES for 2-(2-ethoxybutoxy)ethyl methyl carbonate is CCOC(CC)COCCOC(=O)OC.
What is the InChIKey of 2-(2-ethoxybutoxy)ethyl methyl carbonate?
The InChIKey is JQCVUSITCOGIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5/c1-4-9(14-5-2)8-13-6-7-15-10(11)12-3/h9H,4-8H2,1-3H3.
What are the key properties of 2-(2-ethoxybutoxy)ethyl methyl carbonate?
2-(2-ethoxybutoxy)ethyl methyl carbonate has a molecular weight of 220.26 g/mol, XLogP of 1.60, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxybutoxy)ethyl methyl carbonate is sourced from PubChem (CID 87247647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).