C16H34O6 — CID 121246575
1,2-bis[2-(2-ethoxyethoxy)ethoxy]butane (PubChem CID 121246575) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 1,2-bis[2-(2-ethoxyethoxy)ethoxy]butane.
| Compound Name | 1,2-bis[2-(2-ethoxyethoxy)ethoxy]butane |
|---|---|
| PubChem CID | 121246575 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1,2-bis[2-(2-ethoxyethoxy)ethoxy]butane |
| SMILES | CCOCCOCCOCC(CC)OCCOCCOCC |
| InChI | InChI=1S/C16H34O6/c1-4-16(22-14-13-20-10-8-18-6-3)15-21-12-11-19-9-7-17-5-2/h16H,4-15H2,1-3H3 |
| InChIKey | PHUOKYLGXUVWMN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|