C15H32O6 — CID 140916891
2-[2-[2-[1-(2-propoxyethoxy)butan-2-yloxy]ethoxy]ethoxy]ethanol (PubChem CID 140916891) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[2-[2-[1-(2-propoxyethoxy)butan-2-yloxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[1-(2-propoxyethoxy)butan-2-yloxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 140916891 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[2-[2-[1-(2-propoxyethoxy)butan-2-yloxy]ethoxy]ethoxy]ethanol |
| SMILES | CCCOCCOCC(CC)OCCOCCOCCO |
| InChI | InChI=1S/C15H32O6/c1-3-6-17-10-11-20-14-15(4-2)21-13-12-19-9-8-18-7-5-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | ZTBXVIFCVRSGRL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|