C8H19BO6 — CID 18539415
1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid (PubChem CID 18539415) has the molecular formula C8H19BO6 and a molecular weight of 222.05 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid |
|---|---|
| PubChem CID | 18539415 |
| Molecular Formula | C8H19BO6 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid |
| SMILES | CCC(COCCOCCO)OB(O)O |
| InChI | InChI=1S/C8H19BO6/c1-2-8(15-9(11)12)7-14-6-5-13-4-3-10/h8,10-12H,2-7H2,1H3 |
| InChIKey | DHGPXUPURGFERW-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|