1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid

C8H19BO6 — CID 18539415

IUPAC1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid
SMILESCCC(COCCOCCO)OB(O)O
InChIInChI=1S/C8H19BO6/c1-2-8(15-9(11)12)7-14-6-5-13-4-3-10/h8,10-12H,2-7H2,1H3
InChIKeyDHGPXUPURGFERW-UHFFFAOYSA-N
MW222.05 g/mol
LogP-1.22
Rot. Bonds10

About 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid

1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid (PubChem CID 18539415) has the molecular formula C8H19BO6 and a molecular weight of 222.05 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid.

Molecular Properties

Compound Name1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid
PubChem CID18539415
Molecular FormulaC8H19BO6
Molecular Weight222.05 g/mol
Exact Mass222.13
IUPAC Name1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid
SMILESCCC(COCCOCCO)OB(O)O
InChIInChI=1S/C8H19BO6/c1-2-8(15-9(11)12)7-14-6-5-13-4-3-10/h8,10-12H,2-7H2,1H3
InChIKeyDHGPXUPURGFERW-UHFFFAOYSA-N
XLogP-1.22
TPSA88.38 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.05
LogP ≤ 5-1.22
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid?
The IUPAC name of 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid (CID 18539415) is 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid.
What is the SMILES notation for 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid?
The canonical SMILES for 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid is CCC(COCCOCCO)OB(O)O.
What is the InChIKey of 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid?
The InChIKey is DHGPXUPURGFERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19BO6/c1-2-8(15-9(11)12)7-14-6-5-13-4-3-10/h8,10-12H,2-7H2,1H3.
What are the key properties of 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid?
1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid has a molecular weight of 222.05 g/mol, XLogP of -1.22, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-hydroxyethoxy)ethoxy]butan-2-yloxyboronic acid is sourced from PubChem (CID 18539415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).