C16H34O8 — CID 18724197
2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butoxy]ethoxy]ethoxy]ethanol (PubChem CID 18724197) has the molecular formula C16H34O8 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 18724197 |
| Molecular Formula | C16H34O8 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCC(COCCOCCOCCO)OCCOCCOCCO |
| InChI | InChI=1S/C16H34O8/c1-2-16(24-14-13-22-10-8-20-6-4-18)15-23-12-11-21-9-7-19-5-3-17/h16-18H,2-15H2,1H3 |
| InChIKey | YWROBDZPNJLCLT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|