C31H60O15 — CID 163881594
2-[2,3-bis[2-[3-(2-hydroxyethoxy)pentanoyloxy]ethoxy]propoxy]ethyl 3-(2-hydroxyethoxy)pentanoate;methane (PubChem CID 163881594) has the molecular formula C31H60O15 and a molecular weight of 672.81 g/mol. Its IUPAC name is 2-[2,3-bis[2-[3-(2-hydroxyethoxy)pentanoyloxy]ethoxy]propoxy]ethyl 3-(2-hydroxyethoxy)pentanoate;methane.
| Compound Name | 2-[2,3-bis[2-[3-(2-hydroxyethoxy)pentanoyloxy]ethoxy]propoxy]ethyl 3-(2-hydroxyethoxy)pentanoate;methane |
|---|---|
| PubChem CID | 163881594 |
| Molecular Formula | C31H60O15 |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.39 |
| IUPAC Name | 2-[2,3-bis[2-[3-(2-hydroxyethoxy)pentanoyloxy]ethoxy]propoxy]ethyl 3-(2-hydroxyethoxy)pentanoate;methane |
| SMILES | C.CCC(CC(=O)OCCOCC(COCCOC(=O)CC(CC)OCCO)OCCOC(=O)CC(CC)OCCO)OCCO |
| InChI | InChI=1S/C30H56O15.CH4/c1-4-24(39-10-7-31)19-28(34)43-15-13-37-22-27(42-17-18-45-30(36)21-26(6-3)41-12-9-33)23-38-14-16-44-29(35)20-25(5-2)40-11-8-32;/h24-27,31-33H,4-23H2,1-3H3;1H4 |
| InChIKey | PTRLVYIZXWJIBP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|