C11H20O7 — CID 176616060
2-[2-(2-acetyloxyethoxy)-3-hydroxypropoxy]ethyl acetate (PubChem CID 176616060) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[2-(2-acetyloxyethoxy)-3-hydroxypropoxy]ethyl acetate.
| Compound Name | 2-[2-(2-acetyloxyethoxy)-3-hydroxypropoxy]ethyl acetate |
|---|---|
| PubChem CID | 176616060 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[2-(2-acetyloxyethoxy)-3-hydroxypropoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCC(CO)OCCOC(C)=O |
| InChI | InChI=1S/C11H20O7/c1-9(13)16-4-3-15-8-11(7-12)18-6-5-17-10(2)14/h11-12H,3-8H2,1-2H3 |
| InChIKey | CRIZYMNYVNHMLU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|