About 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate
2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate (PubChem CID 164738437) has the molecular formula C18H32O12
and a molecular weight of 440.44 g/mol. Its IUPAC name is 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate |
| PubChem CID | 164738437 |
| Molecular Formula | C18H32O12 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCOCC(COCCOC(=O)C(C)O)OCCOC(=O)C(C)O |
| InChI | InChI=1S/C18H32O12/c1-12(19)16(22)28-6-4-25-10-15(27-8-9-30-18(24)14(3)21)11-26-5-7-29-17(23)13(2)20/h12-15,19-21H,4-11H2,1-3H3 |
| InChIKey | LSPNBPDVQMZNPU-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate?
The IUPAC name of 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate (CID 164738437) is 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate.
What is the SMILES notation for 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate?
The canonical SMILES for 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate is CC(O)C(=O)OCCOCC(COCCOC(=O)C(C)O)OCCOC(=O)C(C)O.
What is the InChIKey of 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate?
The InChIKey is LSPNBPDVQMZNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O12/c1-12(19)16(22)28-6-4-25-10-15(27-8-9-30-18(24)14(3)21)11-26-5-7-29-17(23)13(2)20/h12-15,19-21H,4-11H2,1-3H3.
What are the key properties of 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate?
2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate has a molecular weight of 440.44 g/mol, XLogP of -1.82, 17 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate is sourced from PubChem (CID 164738437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).