C18H32O12 — CID 164738437
2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate (PubChem CID 164738437) has the molecular formula C18H32O12 and a molecular weight of 440.44 g/mol. Its IUPAC name is 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate.
| Compound Name | 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 164738437 |
| Molecular Formula | C18H32O12 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[2,3-bis[2-(2-hydroxypropanoyloxy)ethoxy]propoxy]ethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCOCC(COCCOC(=O)C(C)O)OCCOC(=O)C(C)O |
| InChI | InChI=1S/C18H32O12/c1-12(19)16(22)28-6-4-25-10-15(27-8-9-30-18(24)14(3)21)11-26-5-7-29-17(23)13(2)20/h12-15,19-21H,4-11H2,1-3H3 |
| InChIKey | LSPNBPDVQMZNPU-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|