C29H50O17 — CID 59854102
2-[2-(2-acetyloxyethoxy)-3-[2-(2-acetyloxyethoxy)-3-[2,3-bis(2-acetyloxyethoxy)propoxy]propoxy]propoxy]ethyl acetate (PubChem CID 59854102) has the molecular formula C29H50O17 and a molecular weight of 670.70 g/mol. Its IUPAC name is 2-[2-(2-acetyloxyethoxy)-3-[2-(2-acetyloxyethoxy)-3-[2,3-bis(2-acetyloxyethoxy)propoxy]propoxy]propoxy]ethyl acetate.
| Compound Name | 2-[2-(2-acetyloxyethoxy)-3-[2-(2-acetyloxyethoxy)-3-[2,3-bis(2-acetyloxyethoxy)propoxy]propoxy]propoxy]ethyl acetate |
|---|---|
| PubChem CID | 59854102 |
| Molecular Formula | C29H50O17 |
| Molecular Weight | 670.70 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 2-[2-(2-acetyloxyethoxy)-3-[2-(2-acetyloxyethoxy)-3-[2,3-bis(2-acetyloxyethoxy)propoxy]propoxy]propoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCC(COCC(COCC(COCCOC(C)=O)OCCOC(C)=O)OCCOC(C)=O)OCCOC(C)=O |
| InChI | InChI=1S/C29H50O17/c1-22(30)39-8-6-35-16-27(44-13-10-41-24(3)32)18-37-20-29(46-15-12-43-26(5)34)21-38-19-28(45-14-11-42-25(4)33)17-36-7-9-40-23(2)31/h27-29H,6-21H2,1-5H3 |
| InChIKey | QBFZCTYIMLLKMO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 196.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|