About 2-(2-ethoxyethoxy)pentyl acetate
2-(2-ethoxyethoxy)pentyl acetate (PubChem CID 87309415) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)pentyl acetate.
Molecular Properties
| Compound Name | 2-(2-ethoxyethoxy)pentyl acetate |
| PubChem CID | 87309415 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(2-ethoxyethoxy)pentyl acetate |
| SMILES | CCCC(COC(C)=O)OCCOCC |
| InChI | InChI=1S/C11H22O4/c1-4-6-11(9-15-10(3)12)14-8-7-13-5-2/h11H,4-9H2,1-3H3 |
| InChIKey | SYOUNEZDXSNDFW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethoxy)pentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethoxy)pentyl acetate?
The IUPAC name of 2-(2-ethoxyethoxy)pentyl acetate (CID 87309415) is 2-(2-ethoxyethoxy)pentyl acetate.
What is the SMILES notation for 2-(2-ethoxyethoxy)pentyl acetate?
The canonical SMILES for 2-(2-ethoxyethoxy)pentyl acetate is CCCC(COC(C)=O)OCCOCC.
What is the InChIKey of 2-(2-ethoxyethoxy)pentyl acetate?
The InChIKey is SYOUNEZDXSNDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-4-6-11(9-15-10(3)12)14-8-7-13-5-2/h11H,4-9H2,1-3H3.
What are the key properties of 2-(2-ethoxyethoxy)pentyl acetate?
2-(2-ethoxyethoxy)pentyl acetate has a molecular weight of 218.29 g/mol, XLogP of 1.77, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethoxy)pentyl acetate is sourced from PubChem (CID 87309415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).