About 2-ethoxypentyl hydrogen carbonate
2-ethoxypentyl hydrogen carbonate (PubChem CID 139923190) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-ethoxypentyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-ethoxypentyl hydrogen carbonate |
| PubChem CID | 139923190 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-ethoxypentyl hydrogen carbonate |
| SMILES | CCCC(COC(=O)O)OCC |
| InChI | InChI=1S/C8H16O4/c1-3-5-7(11-4-2)6-12-8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | LDBPEBLVGVMBHO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxypentyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypentyl hydrogen carbonate?
The IUPAC name of 2-ethoxypentyl hydrogen carbonate (CID 139923190) is 2-ethoxypentyl hydrogen carbonate.
What is the SMILES notation for 2-ethoxypentyl hydrogen carbonate?
The canonical SMILES for 2-ethoxypentyl hydrogen carbonate is CCCC(COC(=O)O)OCC.
What is the InChIKey of 2-ethoxypentyl hydrogen carbonate?
The InChIKey is LDBPEBLVGVMBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-3-5-7(11-4-2)6-12-8(9)10/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethoxypentyl hydrogen carbonate?
2-ethoxypentyl hydrogen carbonate has a molecular weight of 176.21 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypentyl hydrogen carbonate is sourced from PubChem (CID 139923190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).