About (2-ethoxy-3-methylhexyl) hydrogen carbonate
(2-ethoxy-3-methylhexyl) hydrogen carbonate (PubChem CID 90300495) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is (2-ethoxy-3-methylhexyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-ethoxy-3-methylhexyl) hydrogen carbonate |
| PubChem CID | 90300495 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2-ethoxy-3-methylhexyl) hydrogen carbonate |
| SMILES | CCCC(C)C(COC(=O)O)OCC |
| InChI | InChI=1S/C10H20O4/c1-4-6-8(3)9(13-5-2)7-14-10(11)12/h8-9H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | BPOLRBHMDFEGQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethoxy-3-methylhexyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-3-methylhexyl) hydrogen carbonate?
The IUPAC name of (2-ethoxy-3-methylhexyl) hydrogen carbonate (CID 90300495) is (2-ethoxy-3-methylhexyl) hydrogen carbonate.
What is the SMILES notation for (2-ethoxy-3-methylhexyl) hydrogen carbonate?
The canonical SMILES for (2-ethoxy-3-methylhexyl) hydrogen carbonate is CCCC(C)C(COC(=O)O)OCC.
What is the InChIKey of (2-ethoxy-3-methylhexyl) hydrogen carbonate?
The InChIKey is BPOLRBHMDFEGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-4-6-8(3)9(13-5-2)7-14-10(11)12/h8-9H,4-7H2,1-3H3,(H,11,12).
What are the key properties of (2-ethoxy-3-methylhexyl) hydrogen carbonate?
(2-ethoxy-3-methylhexyl) hydrogen carbonate has a molecular weight of 204.27 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-3-methylhexyl) hydrogen carbonate is sourced from PubChem (CID 90300495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).