About 3-ethoxyoctyl hydrogen carbonate
3-ethoxyoctyl hydrogen carbonate (PubChem CID 139923205) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 3-ethoxyoctyl hydrogen carbonate.
Molecular Properties
| Compound Name | 3-ethoxyoctyl hydrogen carbonate |
| PubChem CID | 139923205 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-ethoxyoctyl hydrogen carbonate |
| SMILES | CCCCCC(CCOC(=O)O)OCC |
| InChI | InChI=1S/C11H22O4/c1-3-5-6-7-10(14-4-2)8-9-15-11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | JMYFJKWNHRTTQC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxyoctyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyoctyl hydrogen carbonate?
The IUPAC name of 3-ethoxyoctyl hydrogen carbonate (CID 139923205) is 3-ethoxyoctyl hydrogen carbonate.
What is the SMILES notation for 3-ethoxyoctyl hydrogen carbonate?
The canonical SMILES for 3-ethoxyoctyl hydrogen carbonate is CCCCCC(CCOC(=O)O)OCC.
What is the InChIKey of 3-ethoxyoctyl hydrogen carbonate?
The InChIKey is JMYFJKWNHRTTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-3-5-6-7-10(14-4-2)8-9-15-11(12)13/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 3-ethoxyoctyl hydrogen carbonate?
3-ethoxyoctyl hydrogen carbonate has a molecular weight of 218.29 g/mol, XLogP of 3.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyoctyl hydrogen carbonate is sourced from PubChem (CID 139923205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).