About 3-(2-methoxybutoxy)nonyl hydrogen carbonate
3-(2-methoxybutoxy)nonyl hydrogen carbonate (PubChem CID 87841171) has the molecular formula C15H30O5
and a molecular weight of 290.40 g/mol. Its IUPAC name is 3-(2-methoxybutoxy)nonyl hydrogen carbonate.
Molecular Properties
| Compound Name | 3-(2-methoxybutoxy)nonyl hydrogen carbonate |
| PubChem CID | 87841171 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-(2-methoxybutoxy)nonyl hydrogen carbonate |
| SMILES | CCCCCCC(CCOC(=O)O)OCC(CC)OC |
| InChI | InChI=1S/C15H30O5/c1-4-6-7-8-9-14(10-11-19-15(16)17)20-12-13(5-2)18-3/h13-14H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | INEABHAREJFLED-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxybutoxy)nonyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxybutoxy)nonyl hydrogen carbonate?
The IUPAC name of 3-(2-methoxybutoxy)nonyl hydrogen carbonate (CID 87841171) is 3-(2-methoxybutoxy)nonyl hydrogen carbonate.
What is the SMILES notation for 3-(2-methoxybutoxy)nonyl hydrogen carbonate?
The canonical SMILES for 3-(2-methoxybutoxy)nonyl hydrogen carbonate is CCCCCCC(CCOC(=O)O)OCC(CC)OC.
What is the InChIKey of 3-(2-methoxybutoxy)nonyl hydrogen carbonate?
The InChIKey is INEABHAREJFLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O5/c1-4-6-7-8-9-14(10-11-19-15(16)17)20-12-13(5-2)18-3/h13-14H,4-12H2,1-3H3,(H,16,17).
What are the key properties of 3-(2-methoxybutoxy)nonyl hydrogen carbonate?
3-(2-methoxybutoxy)nonyl hydrogen carbonate has a molecular weight of 290.40 g/mol, XLogP of 3.85, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxybutoxy)nonyl hydrogen carbonate is sourced from PubChem (CID 87841171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).