C17H45O4P — CID 158965859
2,3-dipropoxypropyl acetate;ethylphosphane;methane (PubChem CID 158965859) has the molecular formula C17H45O4P and a molecular weight of 344.52 g/mol. Its IUPAC name is 2,3-dipropoxypropyl acetate;ethylphosphane;methane.
| Compound Name | 2,3-dipropoxypropyl acetate;ethylphosphane;methane |
|---|---|
| PubChem CID | 158965859 |
| Molecular Formula | C17H45O4P |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | 2,3-dipropoxypropyl acetate;ethylphosphane;methane |
| SMILES | C.C.C.C.CCCOCC(COC(C)=O)OCCC.CCP |
| InChI | InChI=1S/C11H22O4.C2H7P.4CH4/c1-4-6-13-8-11(14-7-5-2)9-15-10(3)12;1-2-3;;;;/h11H,4-9H2,1-3H3;2-3H2,1H3;4*1H4 |
| InChIKey | JNEQDYHNEUFVNC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|