C17H31NO7 — CID 59435480
[3-acetyloxy-2-[4-(2-butoxyethylamino)-4-oxobutoxy]propyl] acetate (PubChem CID 59435480) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is [3-acetyloxy-2-[4-(2-butoxyethylamino)-4-oxobutoxy]propyl] acetate.
| Compound Name | [3-acetyloxy-2-[4-(2-butoxyethylamino)-4-oxobutoxy]propyl] acetate |
|---|---|
| PubChem CID | 59435480 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [3-acetyloxy-2-[4-(2-butoxyethylamino)-4-oxobutoxy]propyl] acetate |
| SMILES | CCCCOCCNC(=O)CCCOC(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C17H31NO7/c1-4-5-9-22-11-8-18-17(21)7-6-10-23-16(12-24-14(2)19)13-25-15(3)20/h16H,4-13H2,1-3H3,(H,18,21) |
| InChIKey | NZWXBTHYTBGHRA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|