C17H31N3O7 — CID 58341019
[3-(ethylcarbamoyloxy)-2-[4-oxo-4-(4-oxobutylamino)butoxy]propyl] N-ethylcarbamate (PubChem CID 58341019) has the molecular formula C17H31N3O7 and a molecular weight of 389.45 g/mol. Its IUPAC name is [3-(ethylcarbamoyloxy)-2-[4-oxo-4-(4-oxobutylamino)butoxy]propyl] N-ethylcarbamate.
| Compound Name | [3-(ethylcarbamoyloxy)-2-[4-oxo-4-(4-oxobutylamino)butoxy]propyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 58341019 |
| Molecular Formula | C17H31N3O7 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [3-(ethylcarbamoyloxy)-2-[4-oxo-4-(4-oxobutylamino)butoxy]propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCCC(=O)NCCCC=O |
| InChI | InChI=1S/C17H31N3O7/c1-3-18-16(23)26-12-14(13-27-17(24)19-4-2)25-11-7-8-15(22)20-9-5-6-10-21/h10,14H,3-9,11-13H2,1-2H3,(H,18,23)(H,19,24)(H,20,22) |
| InChIKey | GHWPUZXAJDJEOG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|