C21H43N3O8 — CID 159569361
4-(3,7-dihydroperoxynonan-5-yloxy)-N-[2-(4-oxobutoxy)ethyl]butanamide;methanimine (PubChem CID 159569361) has the molecular formula C21H43N3O8 and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-(3,7-dihydroperoxynonan-5-yloxy)-N-[2-(4-oxobutoxy)ethyl]butanamide;methanimine.
| Compound Name | 4-(3,7-dihydroperoxynonan-5-yloxy)-N-[2-(4-oxobutoxy)ethyl]butanamide;methanimine |
|---|---|
| PubChem CID | 159569361 |
| Molecular Formula | C21H43N3O8 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 4-(3,7-dihydroperoxynonan-5-yloxy)-N-[2-(4-oxobutoxy)ethyl]butanamide;methanimine |
| SMILES | CCC(CC(CC(CC)OO)OCCCC(=O)NCCOCCCC=O)OO.[H]N=C.[H]N=C |
| InChI | InChI=1S/C19H37NO8.2CH3N/c1-3-16(27-23)14-18(15-17(4-2)28-24)26-12-7-8-19(22)20-9-13-25-11-6-5-10-21;2*1-2/h10,16-18,23-24H,3-9,11-15H2,1-2H3,(H,20,22);2*2H,1H2 |
| InChIKey | MHPRQFKUFQBKKV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|