C29H57NO15 — CID 134238129
2,3-bis[2-[2,3-bis(3-hydroxypropoxy)propoxy]ethoxy]propyl N-(3-oxopropyl)carbamate (PubChem CID 134238129) has the molecular formula C29H57NO15 and a molecular weight of 659.77 g/mol. Its IUPAC name is 2,3-bis[2-[2,3-bis(3-hydroxypropoxy)propoxy]ethoxy]propyl N-(3-oxopropyl)carbamate.
| Compound Name | 2,3-bis[2-[2,3-bis(3-hydroxypropoxy)propoxy]ethoxy]propyl N-(3-oxopropyl)carbamate |
|---|---|
| PubChem CID | 134238129 |
| Molecular Formula | C29H57NO15 |
| Molecular Weight | 659.77 g/mol |
| Exact Mass | 659.37 |
| IUPAC Name | 2,3-bis[2-[2,3-bis(3-hydroxypropoxy)propoxy]ethoxy]propyl N-(3-oxopropyl)carbamate |
| SMILES | O=CCCNC(=O)OCC(COCCOCC(COCCCO)OCCCO)OCCOCC(COCCCO)OCCCO |
| InChI | InChI=1S/C29H57NO15/c31-7-1-6-30-29(36)45-25-28(44-19-18-41-23-27(43-15-5-11-35)21-38-13-3-9-33)24-40-17-16-39-22-26(42-14-4-10-34)20-37-12-2-8-32/h7,26-28,32-35H,1-6,8-25H2,(H,30,36) |
| InChIKey | CZNQVQUIXFNSQU-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 210.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.77 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|