C14H28O8 — CID 164775709
2-[2,3-bis(4-hydroxybutoxy)propoxy]ethyl hydrogen carbonate (PubChem CID 164775709) has the molecular formula C14H28O8 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-[2,3-bis(4-hydroxybutoxy)propoxy]ethyl hydrogen carbonate.
| Compound Name | 2-[2,3-bis(4-hydroxybutoxy)propoxy]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 164775709 |
| Molecular Formula | C14H28O8 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[2,3-bis(4-hydroxybutoxy)propoxy]ethyl hydrogen carbonate |
| SMILES | O=C(O)OCCOCC(COCCCCO)OCCCCO |
| InChI | InChI=1S/C14H28O8/c15-5-1-3-7-19-11-13(21-8-4-2-6-16)12-20-9-10-22-14(17)18/h13,15-16H,1-12H2,(H,17,18) |
| InChIKey | WXZNVDBDMHLVAQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|