C16H38O6 — CID 159117576
3-[2,3-bis(3-hydroxypropoxy)propoxy]propan-1-ol;methane;propane (PubChem CID 159117576) has the molecular formula C16H38O6 and a molecular weight of 326.47 g/mol. Its IUPAC name is 3-[2,3-bis(3-hydroxypropoxy)propoxy]propan-1-ol;methane;propane.
| Compound Name | 3-[2,3-bis(3-hydroxypropoxy)propoxy]propan-1-ol;methane;propane |
|---|---|
| PubChem CID | 159117576 |
| Molecular Formula | C16H38O6 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 3-[2,3-bis(3-hydroxypropoxy)propoxy]propan-1-ol;methane;propane |
| SMILES | C.CCC.OCCCOCC(COCCCO)OCCCO |
| InChI | InChI=1S/C12H26O6.C3H8.CH4/c13-4-1-7-16-10-12(18-9-3-6-15)11-17-8-2-5-14;1-3-2;/h12-15H,1-11H2;3H2,1-2H3;1H4 |
| InChIKey | KFGXOIZNXKPHOK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|