C46H90N2O4 — CID 87497893
2,3-bis[(Z)-octadec-9-enoxy]propyl N-[2-(diethylamino)ethyl]carbamate (PubChem CID 87497893) has the molecular formula C46H90N2O4 and a molecular weight of 735.24 g/mol. Its IUPAC name is 2,3-bis[(Z)-octadec-9-enoxy]propyl N-[2-(diethylamino)ethyl]carbamate.
| Compound Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl N-[2-(diethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 87497893 |
| Molecular Formula | C46H90N2O4 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.69 |
| IUPAC Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl N-[2-(diethylamino)ethyl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COC(=O)NCCN(CC)CC)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H90N2O4/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41-50-43-45(44-52-46(49)47-39-40-48(7-3)8-4)51-42-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h21-24,45H,5-20,25-44H2,1-4H3,(H,47,49)/b23-21-,24-22- |
| InChIKey | ZFTLJYMSWDCTTJ-SXAUZNKPSA-N |
| XLogP | 13.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|