C15H32NO9P — CID 59728810
4-[2,3-bis(2-methoxyethoxy)propoxycarbonylamino]butoxy-methylphosphinic acid (PubChem CID 59728810) has the molecular formula C15H32NO9P and a molecular weight of 401.39 g/mol. Its IUPAC name is 4-[2,3-bis(2-methoxyethoxy)propoxycarbonylamino]butoxy-methylphosphinic acid.
| Compound Name | 4-[2,3-bis(2-methoxyethoxy)propoxycarbonylamino]butoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 59728810 |
| Molecular Formula | C15H32NO9P |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[2,3-bis(2-methoxyethoxy)propoxycarbonylamino]butoxy-methylphosphinic acid |
| SMILES | COCCOCC(COC(=O)NCCCCOP(C)(=O)O)OCCOC |
| InChI | InChI=1S/C15H32NO9P/c1-20-8-10-22-12-14(23-11-9-21-2)13-24-15(17)16-6-4-5-7-25-26(3,18)19/h14H,4-13H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | ZEVGNSQTQYMAAO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|