About N-ethyl-5-oxopentanamide
N-ethyl-5-oxopentanamide (PubChem CID 54062498) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is N-ethyl-5-oxopentanamide.
Molecular Properties
| Compound Name | N-ethyl-5-oxopentanamide |
| PubChem CID | 54062498 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-ethyl-5-oxopentanamide |
| SMILES | CCNC(=O)CCCC=O |
| InChI | InChI=1S/C7H13NO2/c1-2-8-7(10)5-3-4-6-9/h6H,2-5H2,1H3,(H,8,10) |
| InChIKey | XACUUVKOLXQLLP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-oxopentanamide?
The IUPAC name of N-ethyl-5-oxopentanamide (CID 54062498) is N-ethyl-5-oxopentanamide.
What is the SMILES notation for N-ethyl-5-oxopentanamide?
The canonical SMILES for N-ethyl-5-oxopentanamide is CCNC(=O)CCCC=O.
What is the InChIKey of N-ethyl-5-oxopentanamide?
The InChIKey is XACUUVKOLXQLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-8-7(10)5-3-4-6-9/h6H,2-5H2,1H3,(H,8,10).
What are the key properties of N-ethyl-5-oxopentanamide?
N-ethyl-5-oxopentanamide has a molecular weight of 143.19 g/mol, XLogP of 0.49, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-oxopentanamide is sourced from PubChem (CID 54062498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).