About N'-ethylnonanediamide
N'-ethylnonanediamide (PubChem CID 18377762) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-ethylnonanediamide.
Molecular Properties
| Compound Name | N'-ethylnonanediamide |
| PubChem CID | 18377762 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N'-ethylnonanediamide |
| SMILES | CCNC(=O)CCCCCCCC(N)=O |
| InChI | InChI=1S/C11H22N2O2/c1-2-13-11(15)9-7-5-3-4-6-8-10(12)14/h2-9H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | BVYVAZPQXQAETP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylnonanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylnonanediamide?
The IUPAC name of N'-ethylnonanediamide (CID 18377762) is N'-ethylnonanediamide.
What is the SMILES notation for N'-ethylnonanediamide?
The canonical SMILES for N'-ethylnonanediamide is CCNC(=O)CCCCCCCC(N)=O.
What is the InChIKey of N'-ethylnonanediamide?
The InChIKey is BVYVAZPQXQAETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-2-13-11(15)9-7-5-3-4-6-8-10(12)14/h2-9H2,1H3,(H2,12,14)(H,13,15).
What are the key properties of N'-ethylnonanediamide?
N'-ethylnonanediamide has a molecular weight of 214.31 g/mol, XLogP of 1.34, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylnonanediamide is sourced from PubChem (CID 18377762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).