About N-ethyloctadecanamide;octadecanamide
N-ethyloctadecanamide;octadecanamide (PubChem CID 159879248) has the molecular formula C38H78N2O2
and a molecular weight of 595.05 g/mol. Its IUPAC name is N-ethyloctadecanamide;octadecanamide.
Molecular Properties
| Compound Name | N-ethyloctadecanamide;octadecanamide |
| PubChem CID | 159879248 |
| Molecular Formula | C38H78N2O2 |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.61 |
| IUPAC Name | N-ethyloctadecanamide;octadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)NCC.CCCCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C20H41NO.C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-19H2,1-2H3,(H,21,22);2-17H2,1H3,(H2,19,20) |
| InChIKey | NTHWKZDMRXNMIW-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyloctadecanamide;octadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyloctadecanamide;octadecanamide?
The IUPAC name of N-ethyloctadecanamide;octadecanamide (CID 159879248) is N-ethyloctadecanamide;octadecanamide.
What is the SMILES notation for N-ethyloctadecanamide;octadecanamide?
The canonical SMILES for N-ethyloctadecanamide;octadecanamide is CCCCCCCCCCCCCCCCCC(=O)NCC.CCCCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of N-ethyloctadecanamide;octadecanamide?
The InChIKey is NTHWKZDMRXNMIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO.C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-19H2,1-2H3,(H,21,22);2-17H2,1H3,(H2,19,20).
What are the key properties of N-ethyloctadecanamide;octadecanamide?
N-ethyloctadecanamide;octadecanamide has a molecular weight of 595.05 g/mol, XLogP of 12.12, 33 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyloctadecanamide;octadecanamide is sourced from PubChem (CID 159879248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).